cas: 7681-93-8 — see every product listed under this CAS number, including other names
Natamycin, 99.07% (CAS 7681-93-8) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 5 g, 50 mg, 1 g, 200 mg, 500 mg, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-B0133-100 mg |
| cas | 7681-93-8 |
| size | 100 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 630.84 Pln | |
| MedChemExpress | 5 g | 7917.28 Pln | |
| MedChemExpress | 50 mg | 435.79 Pln | |
| MedChemExpress | 1 g | 3236.12 Pln | |
| MedChemExpress | 200 mg | 1034.87 Pln | |
| MedChemExpress | 500 mg | 2019.40 Pln | |
| MedChemExpress | 10mM/1mL | 468.30 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.07% |
(1R,3S,5R,7R,8E,12R,14E,16E,18E,20E,22R,24S,25R,26S)-22-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-1,3,26-trihydroxy-12-methyl-10-oxo-6,11,28-trioxatricyclo[22.3.1.05,7]octacosa-8,14,16,18,20-pentaene-25-carboxylic acid (CAS 7681-93-8) is a chemical compound with the molecular formula C33H47NO13 and a molecular weight of 665.7 g/mol. IUPAC name: (1R,3S,5R,7R,8E,12R,14E,16E,18E,20E,22R,24S,25R,26S)-22-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-1,3,26-trihydroxy-12-methyl-10-oxo-6,11,28-trioxatricyclo[22.3.1.05,7]octacosa-8,14,16,18,20-pentaene-25-carboxylic acid. InChIKey: NCXMLFZGDNKEPB-FFPOYIOWSA-N.
| Molecular formula | C33H47NO13 |
|---|---|
| Molecular weight | 665.7 g/mol |
| IUPAC name | (1R,3S,5R,7R,8E,12R,14E,16E,18E,20E,22R,24S,25R,26S)-22-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-1,3,26-trihydroxy-12-methyl-10-oxo-6,11,28-trioxatricyclo[22.3.1.05,7]octacosa-8,14,16,18,20-pentaene-25-carboxylic acid |
| InChIKey | NCXMLFZGDNKEPB-FFPOYIOWSA-N |
| SMILES | C[C@@H]1C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@@H]3[C@H](O3)/C=C/C(=O)O1)O)O)O)C(=O)O)O[C@H]4[C@H]([C@H]([C@@H]([C@H](O4)C)O)N)O |
Computed by PubChem (NCBI)