Pimaricin, 95.00%
cas: 7681-93-8 — see every product listed under this CAS number, including other names
Pimaricin, 95.00% (CAS 7681-93-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 500mg, 50mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM51000A-100mg |
| cas | 7681-93-8 |
| size | 100mg |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 212.94 Pln | |
| Chemat | 1g | 507.07 Pln | |
| Chemat | 500mg | 339.13 Pln | |
| Chemat | 50mg | 150.79 Pln | |
| Chemat | 5g | 1388.12 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 95.00% |
| category | Chemicals |
(1R,3S,5R,7R,8E,12R,14E,16E,18E,20E,22R,24S,25R,26S)-22-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-1,3,26-trihydroxy-12-methyl-10-oxo-6,11,28-trioxatricyclo[22.3.1.05,7]octacosa-8,14,16,18,20-pentaene-25-carboxylic acid (CAS 7681-93-8) is a chemical compound with the molecular formula C33H47NO13 and a molecular weight of 665.7 g/mol. IUPAC name: (1R,3S,5R,7R,8E,12R,14E,16E,18E,20E,22R,24S,25R,26S)-22-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-1,3,26-trihydroxy-12-methyl-10-oxo-6,11,28-trioxatricyclo[22.3.1.05,7]octacosa-8,14,16,18,20-pentaene-25-carboxylic acid. InChIKey: NCXMLFZGDNKEPB-FFPOYIOWSA-N.
| Molecular formula | C33H47NO13 |
|---|---|
| Molecular weight | 665.7 g/mol |
| IUPAC name | (1R,3S,5R,7R,8E,12R,14E,16E,18E,20E,22R,24S,25R,26S)-22-[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-1,3,26-trihydroxy-12-methyl-10-oxo-6,11,28-trioxatricyclo[22.3.1.05,7]octacosa-8,14,16,18,20-pentaene-25-carboxylic acid |
| InChIKey | NCXMLFZGDNKEPB-FFPOYIOWSA-N |
| SMILES | C[C@@H]1C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](C[C@@H]3[C@H](O3)/C=C/C(=O)O1)O)O)O)C(=O)O)O[C@H]4[C@H]([C@H]([C@@H]([C@H](O4)C)O)N)O |
Computed by PubChem (NCBI)
Synonyms:
NATAMYCIN, pimaricin, Myprozine, Pimafucin, Tennecetin, Natacyn, Natamicina, Natamycine, Delvocid, Mycophyt