CAS 1383718-29-3 appears in our catalog under these names: NecroX-5/ 99.68% (existing batch purity), NecroX–5, NecroX-5 98%, Necrox-5 (methanesulfonate), NecroX-5, 98.16%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 100mg.
5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-(oxan-4-ylmethyl)-2-phenyl-1H-indol-7-amine;methanesulfonic acid (CAS 1383718-29-3) is a chemical compound with the molecular formula C27H39N3O9S3 and a molecular weight of 645.8 g/mol. IUPAC name: 5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-(oxan-4-ylmethyl)-2-phenyl-1H-indol-7-amine;methanesulfonic acid. InChIKey: ZWWWDIWEZYRVMB-UHFFFAOYSA-N.
| Molecular formula | C27H39N3O9S3 |
|---|---|
| Molecular weight | 645.8 g/mol |
| IUPAC name | 5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-(oxan-4-ylmethyl)-2-phenyl-1H-indol-7-amine;methanesulfonic acid |
| InChIKey | ZWWWDIWEZYRVMB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.C1COCCC1CNC2=CC(=CC3=C2NC(=C3)C4=CC=CC=C4)CN5CCS(=O)(=O)CC5 |
Computed by PubChem (NCBI)