CAS 1120332-55-9 appears in our catalog under these names: NecroX-7/ 98.08% (existing batch purity), NecroX–7, NecroX-7 99%, 4-((2-Phenyl-7-((tetrahydro-2H-pyran-4-yl)amino)-1H-indol-5-yl)methyl)thiomorpholine 1,1-dioxide, NecroX-7, 99.69%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 10mM (in 1ml dmso), 50mg, 100mg, 250mg.
5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-(oxan-4-yl)-2-phenyl-1H-indol-7-amine (CAS 1120332-55-9) is a chemical compound with the molecular formula C24H29N3O3S and a molecular weight of 439.6 g/mol. IUPAC name: 5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-(oxan-4-yl)-2-phenyl-1H-indol-7-amine. InChIKey: UZRCNCPUOFYHRB-UHFFFAOYSA-N.
| Molecular formula | C24H29N3O3S |
|---|---|
| Molecular weight | 439.6 g/mol |
| IUPAC name | 5-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-(oxan-4-yl)-2-phenyl-1H-indol-7-amine |
| InChIKey | UZRCNCPUOFYHRB-UHFFFAOYSA-N |
| SMILES | C1COCCC1NC2=CC(=CC3=C2NC(=C3)C4=CC=CC=C4)CN5CCS(=O)(=O)CC5 |
Computed by PubChem (NCBI)