CAS 1507367-00-1 appears in our catalog under these names: NCL 00017509, Nek2-IN-5/ 98.11% (existing batch purity), Nek2-IN-5 99%, Nek2-IN-5, Nek2-IN-5, 99%, 99%. Offered by: GLPBio, TargetMol, Ambeed, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg.
2-[3-[(6-ethynyl-7H-purin-2-yl)amino]phenyl]acetamide (CAS 1507367-00-1) is a chemical compound with the molecular formula C15H12N6O and a molecular weight of 292.30 g/mol. IUPAC name: 2-[3-[(6-ethynyl-7H-purin-2-yl)amino]phenyl]acetamide. InChIKey: CJQGLUJHMXCLQY-UHFFFAOYSA-N.
| Molecular formula | C15H12N6O |
|---|---|
| Molecular weight | 292.30 g/mol |
| IUPAC name | 2-[3-[(6-ethynyl-7H-purin-2-yl)amino]phenyl]acetamide |
| InChIKey | CJQGLUJHMXCLQY-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C(=NC(=N1)NC3=CC=CC(=C3)CC(=O)N)N=CN2 |
Computed by PubChem (NCBI)