CAS 640290-67-1 appears in our catalog under these names: Neu2000, Nelonemdaz/ 98.95% (existing batch purity), Nelonemdaz 98%, 2-Hydroxy-5-((2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzyl)amino)benzoic acid, 98%, 98%, Nelonemdaz, 99.84%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
2-hydroxy-5-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methylamino]benzoic acid (CAS 640290-67-1) is a chemical compound with the molecular formula C15H8F7NO3 and a molecular weight of 383.22 g/mol. IUPAC name: 2-hydroxy-5-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methylamino]benzoic acid. InChIKey: HABROHXUHNHQMY-UHFFFAOYSA-N.
| Molecular formula | C15H8F7NO3 |
|---|---|
| Molecular weight | 383.22 g/mol |
| IUPAC name | 2-hydroxy-5-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methylamino]benzoic acid |
| InChIKey | HABROHXUHNHQMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NCC2=C(C(=C(C(=C2F)F)C(F)(F)F)F)F)C(=O)O)O |
Computed by PubChem (NCBI)