cas: 60871-84-3 — see every product listed under this CAS number, including other names
Nickel(II) trifluoromethanesulfonate, 98% (CAS 60871-84-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F529889-5G |
| cas | 60871-84-3 |
| size | 5g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 25g | 195.78 Pln | |
| Fluorochem | 100g | 523.79 Pln | |
| Fluorochem | 500g | 1830.62 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 704.12 Pln | |
| Ambeed | 500g | 2612.06 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Nickel(2+);bis(trifluoromethanesulfonate) (CAS 60871-84-3) is a chemical compound with the molecular formula C2F6NiO6S2 and a molecular weight of 356.84 g/mol. IUPAC name: nickel(2+);bis(trifluoromethanesulfonate). InChIKey: KVRSDIJOUNNFMZ-UHFFFAOYSA-L.
| Molecular formula | C2F6NiO6S2 |
|---|---|
| Molecular weight | 356.84 g/mol |
| IUPAC name | nickel(2+);bis(trifluoromethanesulfonate) |
| InChIKey | KVRSDIJOUNNFMZ-UHFFFAOYSA-L |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Ni+2] |
Computed by PubChem (NCBI)