CAS 742058-34-0 appears in our catalog under these names: Nurr1 agonist 2, 98%, Nurr1 agonist 2/ 98.4% (existing batch purity), Nurr1 agonist 2, Nurr1 agonist 2, Nurr1 agonist 2, 98.03%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 25mg, 50mg, 500mg, 200mg.
5-(4-phenylmethoxyphenyl)thiophene-2-carboxylic acid (CAS 742058-34-0) is a chemical compound with the molecular formula C18H14O3S and a molecular weight of 310.4 g/mol. IUPAC name: 5-(4-phenylmethoxyphenyl)thiophene-2-carboxylic acid. InChIKey: BRNQGIMGJSDTMI-UHFFFAOYSA-N.
| Molecular formula | C18H14O3S |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 5-(4-phenylmethoxyphenyl)thiophene-2-carboxylic acid |
| InChIKey | BRNQGIMGJSDTMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C3=CC=C(S3)C(=O)O |
Computed by PubChem (NCBI)