Products 113589-51-8

CAS 113589-51-8 is the registry number for 3-(Benzyloxy)-5-phenylthiophene-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

5-phenyl-3-phenylmethoxythiophene-2-carboxylic acid (CAS 113589-51-8) is a chemical compound with the molecular formula C18H14O3S and a molecular weight of 310.4 g/mol. IUPAC name: 5-phenyl-3-phenylmethoxythiophene-2-carboxylic acid. InChIKey: XAWMCAWSRFMDJA-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14O3S
Molecular weight310.4 g/mol
IUPAC name5-phenyl-3-phenylmethoxythiophene-2-carboxylic acid
InChIKeyXAWMCAWSRFMDJA-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(SC(=C2)C3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)