cas: 138797-71-4 — see every product listed under this CAS number, including other names
O-(1,1-Dimethylethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-threonine, 98%, 98% (CAS 138797-71-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1120KV-1g |
| cas | 138797-71-4 |
| size | 1g |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 304.40 Pln | |
| Chemat | 100g | 971.60 Pln | |
| Chemat | 500g | 3076.80 Pln | |
| Chemat | 50g | 539.60 Pln | |
| Chemat | 250g | 2267.60 Pln | |
| Chemat | 1kg | 5339.60 Pln | |
| Chemat | 5kg | 26788.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid (CAS 138797-71-4) is a chemical compound with the molecular formula C23H27NO5 and a molecular weight of 397.5 g/mol. IUPAC name: (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid. InChIKey: LZOLWEQBVPVDPR-VBKZILBWSA-N.
| Molecular formula | C23H27NO5 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid |
| InChIKey | LZOLWEQBVPVDPR-VBKZILBWSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C |
Computed by PubChem (NCBI)