cas: 170643-02-4 — see every product listed under this CAS number, including other names
O-(tert-Butyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-allothreonine, 98%, 98% (CAS 170643-02-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148OP-100mg |
| cas | 170643-02-4 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 784.40 Pln | |
| Chemat | 10g | 1403.60 Pln | |
| Chemat | 25g | 3270.80 Pln | |
| Chemat | 100g | 11205.20 Pln | |
| Chemat | 250g | 15126.80 Pln | |
| Chemat | 500g | 30028.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid (CAS 170643-02-4) is a chemical compound with the molecular formula C23H27NO5 and a molecular weight of 397.5 g/mol. IUPAC name: (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid. InChIKey: LZOLWEQBVPVDPR-JLTOFOAXSA-N.
| Molecular formula | C23H27NO5 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid |
| InChIKey | LZOLWEQBVPVDPR-JLTOFOAXSA-N |
| SMILES | C[C@H]([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C |
Computed by PubChem (NCBI)