CAS 402473-54-5 appears in our catalog under these names: ONO–AE3–208, ONO-AE3-208/ 98.04% (existing batch purity), 4-Cyano-2-[[2-(4-fluoro-1-naphthalenyl)-1-oxopropyl]amino]benzenebutanoic acid, 98%, 98%, ONO-AE3-208, 98.65%, ONO-AE3-208, 98%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Ambeed. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 1mg, 10mM/1mL.
4-[4-cyano-2-[2-(4-fluoronaphthalen-1-yl)propanoylamino]phenyl]butanoic acid (CAS 402473-54-5) is a chemical compound with the molecular formula C24H21FN2O3 and a molecular weight of 404.4 g/mol. IUPAC name: 4-[4-cyano-2-[2-(4-fluoronaphthalen-1-yl)propanoylamino]phenyl]butanoic acid. InChIKey: MTDIMKNAJUQTIO-UHFFFAOYSA-N.
| Molecular formula | C24H21FN2O3 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 4-[4-cyano-2-[2-(4-fluoronaphthalen-1-yl)propanoylamino]phenyl]butanoic acid |
| InChIKey | MTDIMKNAJUQTIO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C2=CC=CC=C21)F)C(=O)NC3=C(C=CC(=C3)C#N)CCCC(=O)O |
Computed by PubChem (NCBI)