ONX–0914 (PR–957)
cas: 960374-59-8 — see every product listed under this CAS number, including other names
ONX–0914 (PR–957) (CAS 960374-59-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 200mg, 5mg, 10mM (in 1ml dmso), 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC15778-10 |
| cas | 960374-59-8 |
| size | 10mg |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1107.21 Pln | |
| GLPBio | 100mg | 2740.71 Pln | |
| GLPBio | 200mg | 4626.95 Pln | |
| GLPBio | 5mg | 765.54 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 887.23 Pln | |
| GLPBio | 50mg | 1959.07 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-3-(4-methoxyphenyl)-N-[(2S)-1-[(2S)-2-methyloxiran-2-yl]-1-oxo-3-phenylpropan-2-yl]-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide (CAS 960374-59-8) is a chemical compound with the molecular formula C31H40N4O7 and a molecular weight of 580.7 g/mol. IUPAC name: (2S)-3-(4-methoxyphenyl)-N-[(2S)-1-[(2S)-2-methyloxiran-2-yl]-1-oxo-3-phenylpropan-2-yl]-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide. InChIKey: WQAVPPWWLLVGFK-FRDWYVIJSA-N.
| Molecular formula | C31H40N4O7 |
|---|---|
| Molecular weight | 580.7 g/mol |
| IUPAC name | (2S)-3-(4-methoxyphenyl)-N-[(2S)-1-[(2S)-2-methyloxiran-2-yl]-1-oxo-3-phenylpropan-2-yl]-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide |
| InChIKey | WQAVPPWWLLVGFK-FRDWYVIJSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)OC)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)[C@@]3(CO3)C)NC(=O)CN4CCOCC4 |
Computed by PubChem (NCBI)