cas: 960374-59-8 — see every product listed under this CAS number, including other names
ONX-0914 99% (CAS 960374-59-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A354826-10mg |
| cas | 960374-59-8 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 748.62 Pln | |
| Ambeed | 25mg | 1432.81 Pln | |
| Ambeed | 50mg | 2367.31 Pln | |
| Ambeed | 100mg | 3969.31 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A354826 |
(2S)-3-(4-methoxyphenyl)-N-[(2S)-1-[(2S)-2-methyloxiran-2-yl]-1-oxo-3-phenylpropan-2-yl]-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide (CAS 960374-59-8) is a chemical compound with the molecular formula C31H40N4O7 and a molecular weight of 580.7 g/mol. IUPAC name: (2S)-3-(4-methoxyphenyl)-N-[(2S)-1-[(2S)-2-methyloxiran-2-yl]-1-oxo-3-phenylpropan-2-yl]-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide. InChIKey: WQAVPPWWLLVGFK-FRDWYVIJSA-N.
| Molecular formula | C31H40N4O7 |
|---|---|
| Molecular weight | 580.7 g/mol |
| IUPAC name | (2S)-3-(4-methoxyphenyl)-N-[(2S)-1-[(2S)-2-methyloxiran-2-yl]-1-oxo-3-phenylpropan-2-yl]-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide |
| InChIKey | WQAVPPWWLLVGFK-FRDWYVIJSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)OC)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)[C@@]3(CO3)C)NC(=O)CN4CCOCC4 |
Computed by PubChem (NCBI)