CAS 1580000-17-4 appears in our catalog under these names: OS-3-106, 99%, OS-3-106/ 99.4% (existing batch purity), OS–3–106, OS-3-106, OS-3-106, 97.03%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 50 mg, 10 mg, 100 mg.
N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-4-(1,3-thiazol-4-yl)benzamide (CAS 1580000-17-4) is a chemical compound with the molecular formula C25H30N4O2S and a molecular weight of 450.6 g/mol. IUPAC name: N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-4-(1,3-thiazol-4-yl)benzamide. InChIKey: RGWFVVKSJUSKTE-UHFFFAOYSA-N.
| Molecular formula | C25H30N4O2S |
|---|---|
| Molecular weight | 450.6 g/mol |
| IUPAC name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-4-(1,3-thiazol-4-yl)benzamide |
| InChIKey | RGWFVVKSJUSKTE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2CCN(CC2)CCCCNC(=O)C3=CC=C(C=C3)C4=CSC=N4 |
Computed by PubChem (NCBI)