CAS 1269826-44-9 appears in our catalog under these names: OSBPL7-IN-1/ 99.89% (existing batch purity), OSBPL7–IN–1, OSBPL7-IN-1 99%, OSBPL7-IN-1, OSBPL7-IN-1, 99.84%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
5-(3,4-dichlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (CAS 1269826-44-9) is a chemical compound with the molecular formula C20H19Cl2F3N2O3 and a molecular weight of 463.3 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide. InChIKey: GYXGGHPMGUITOT-IAGOWNOFSA-N.
| Molecular formula | C20H19Cl2F3N2O3 |
|---|---|
| Molecular weight | 463.3 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| InChIKey | GYXGGHPMGUITOT-IAGOWNOFSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)NC(=O)C2=CC(=C(N=C2)OCC(F)(F)F)C3=CC(=C(C=C3)Cl)Cl)O |
Computed by PubChem (NCBI)