cas: 887686-02-4 — see every product listed under this CAS number, including other names
OSS-128167, 98%, 98% (CAS 887686-02-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EO77-1mg |
| cas | 887686-02-4 |
| size | 1mg |
| availability | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 122.00 Pln | |
| Chemat | 5mg | 131.60 Pln | |
| Chemat | 10mg | 179.60 Pln | |
| Chemat | 25mg | 294.80 Pln | |
| Chemat | 50mg | 462.80 Pln | |
| Chemat | 100mg | 746.00 Pln | |
| Chemat | 250mg | 1269.20 Pln | |
| Chemat | 500mg | 1518.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-[[3-(furan-2-carbonylamino)benzoyl]amino]-2-hydroxybenzoic acid (CAS 887686-02-4) is a chemical compound with the molecular formula C19H14N2O6 and a molecular weight of 366.3 g/mol. IUPAC name: 5-[[3-(furan-2-carbonylamino)benzoyl]amino]-2-hydroxybenzoic acid. InChIKey: HTJWLEGCECXGSQ-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O6 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | 5-[[3-(furan-2-carbonylamino)benzoyl]amino]-2-hydroxybenzoic acid |
| InChIKey | HTJWLEGCECXGSQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC=CO2)C(=O)NC3=CC(=C(C=C3)O)C(=O)O |
Computed by PubChem (NCBI)