CAS 2231300-36-8 is the registry number for 5-((3-(4-Carboxyphenyl)-1H-pyrazol-1-yl)methyl)isophthalic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[[3-(4-carboxyphenyl)pyrazol-1-yl]methyl]benzene-1,3-dicarboxylic acid (CAS 2231300-36-8) is a chemical compound with the molecular formula C19H14N2O6 and a molecular weight of 366.3 g/mol. IUPAC name: 5-[[3-(4-carboxyphenyl)pyrazol-1-yl]methyl]benzene-1,3-dicarboxylic acid. InChIKey: ZMGRPOHAWZHBAH-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O6 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | 5-[[3-(4-carboxyphenyl)pyrazol-1-yl]methyl]benzene-1,3-dicarboxylic acid |
| InChIKey | ZMGRPOHAWZHBAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN(C=C2)CC3=CC(=CC(=C3)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)