cas: 1338540-63-8 — see every product listed under this CAS number, including other names
OTS514 (CAS 1338540-63-8) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 100mg, 25mg, 10mM (in 1ml dmso), 50mg. Offered by: TargetMol, GLPBio, Biosynth.
| brand | TargetMol |
|---|---|
| catalog number | T4134L-2mg |
| cas | 1338540-63-8 |
| size | 2mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| TargetMol | 2mg | 757.88 Pln | |
| TargetMol | 5mg | 1176.01 Pln | |
| TargetMol | 10mg | 1893.21 Pln | |
| GLPBio | 10mg | 1593.99 Pln | |
| GLPBio | 100mg | 6756.58 Pln | |
| GLPBio | 2mg | 784.26 Pln | |
| GLPBio | 25mg | 2778.15 Pln | |
| GLPBio | 5mg | 1088.49 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 952.76 Pln | |
| GLPBio | 50mg | 4126.14 Pln | |
| Biosynth | 25mg | price on request | |
| Biosynth | 10mg | price on request | |
| Biosynth | 50mg | price on request |
| purity | No data |
|---|---|
| delivery time | approx. 26 days |
9-[4-[(2R)-1-aminopropan-2-yl]phenyl]-8-hydroxy-6-methyl-5H-thieno[2,3-c]quinolin-4-one (CAS 1338540-63-8) is a chemical compound with the molecular formula C21H20N2O2S and a molecular weight of 364.5 g/mol. IUPAC name: 9-[4-[(2R)-1-aminopropan-2-yl]phenyl]-8-hydroxy-6-methyl-5H-thieno[2,3-c]quinolin-4-one. InChIKey: OETLNMOJNONWOY-LBPRGKRZSA-N.
| Molecular formula | C21H20N2O2S |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | 9-[4-[(2R)-1-aminopropan-2-yl]phenyl]-8-hydroxy-6-methyl-5H-thieno[2,3-c]quinolin-4-one |
| InChIKey | OETLNMOJNONWOY-LBPRGKRZSA-N |
| SMILES | CC1=CC(=C(C2=C1NC(=O)C3=C2C=CS3)C4=CC=C(C=C4)[C@@H](C)CN)O |
Computed by PubChem (NCBI)