CAS 1338541-25-5 is the registry number for (S)-OTS514. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-[4-[(2S)-1-aminopropan-2-yl]phenyl]-8-hydroxy-6-methyl-5H-thieno[2,3-c]quinolin-4-one (CAS 1338541-25-5) is a chemical compound with the molecular formula C21H20N2O2S and a molecular weight of 364.5 g/mol. IUPAC name: 9-[4-[(2S)-1-aminopropan-2-yl]phenyl]-8-hydroxy-6-methyl-5H-thieno[2,3-c]quinolin-4-one. InChIKey: OETLNMOJNONWOY-GFCCVEGCSA-N.
| Molecular formula | C21H20N2O2S |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | 9-[4-[(2S)-1-aminopropan-2-yl]phenyl]-8-hydroxy-6-methyl-5H-thieno[2,3-c]quinolin-4-one |
| InChIKey | OETLNMOJNONWOY-GFCCVEGCSA-N |
| SMILES | CC1=CC(=C(C2=C1NC(=O)C3=C2C=CS3)C4=CC=C(C=C4)[C@H](C)CN)O |
Computed by PubChem (NCBI)