CAS 126519-80-0 appears in our catalog under these names: OTs-C6-OBn/ 97.31% (existing batch purity), OTs–C6–OBn, OTs-C6-OBn 95%, OTs-C6-OBn, 98%, 98%, OTs-C6-OBn, 98.07%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 25mg, 500mg, 100mg, 250mg, 1g, 5g, 50mg, 50 mg.
6-phenylmethoxyhexyl 4-methylbenzenesulfonate (CAS 126519-80-0) is a chemical compound with the molecular formula C20H26O4S and a molecular weight of 362.5 g/mol. IUPAC name: 6-phenylmethoxyhexyl 4-methylbenzenesulfonate. InChIKey: VVUMHKDBEGSVMR-UHFFFAOYSA-N.
| Molecular formula | C20H26O4S |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | 6-phenylmethoxyhexyl 4-methylbenzenesulfonate |
| InChIKey | VVUMHKDBEGSVMR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCCCCOCC2=CC=CC=C2 |
Computed by PubChem (NCBI)