CAS 3028055-45-7 appears in our catalog under these names: OX04528/ 99.74% (existing batch purity), OX04528, OX04528, 99.71%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
5-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-1-oxidopyridin-1-ium-3-ol (CAS 3028055-45-7) is a chemical compound with the molecular formula C16H13F6NO2 and a molecular weight of 365.27 g/mol. IUPAC name: 5-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-1-oxidopyridin-1-ium-3-ol. InChIKey: DPLHUGXFERHOJE-UHFFFAOYSA-N.
| Molecular formula | C16H13F6NO2 |
|---|---|
| Molecular weight | 365.27 g/mol |
| IUPAC name | 5-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-1-oxidopyridin-1-ium-3-ol |
| InChIKey | DPLHUGXFERHOJE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CCCC2=CC(=C[N+](=C2)[O-])O |
Computed by PubChem (NCBI)