Products 2231747-03-6
CAS 2231747-03-6 appears in our catalog under these names: OXFBD04/ 98.84% (existing batch purity), OXFBD04, α-(3-(3,5-Dimethyl-4-isoxazolyl)-5-hydroxyphenyl)-3-pyridinemethanol, OXFBD04, 99.56% ,, 99.56% ,, OXFBD04, 98.99%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[hydroxy(pyridin-3-yl)methyl]phenol (CAS 2231747-03-6) is a chemical compound with the molecular formula C17H16N2O3 and a molecular weight of 296.32 g/mol. IUPAC name: 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[hydroxy(pyridin-3-yl)methyl]phenol. InChIKey: RFDVEAHRRMEOHK-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O3 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[hydroxy(pyridin-3-yl)methyl]phenol |
| InChIKey | RFDVEAHRRMEOHK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC(=CC(=C2)O)C(C3=CN=CC=C3)O |
Computed by PubChem (NCBI)