cas: 706-78-5 — see every product listed under this CAS number, including other names
Octachlorocyclopentene, ≥98%, ≥98% (CAS 706-78-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TG1-1g |
| cas | 706-78-5 |
| size | 1g |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 323.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
1,2,3,3,4,4,5,5-octachlorocyclopentene (CAS 706-78-5) is a chemical compound with the molecular formula C5Cl8 and a molecular weight of 343.7 g/mol. IUPAC name: 1,2,3,3,4,4,5,5-octachlorocyclopentene. InChIKey: DMZRCHJVWAKCAX-UHFFFAOYSA-N.
| Molecular formula | C5Cl8 |
|---|---|
| Molecular weight | 343.7 g/mol |
| IUPAC name | 1,2,3,3,4,4,5,5-octachlorocyclopentene |
| InChIKey | DMZRCHJVWAKCAX-UHFFFAOYSA-N |
| SMILES | C1(=C(C(C(C1(Cl)Cl)(Cl)Cl)(Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)