CAS 706-78-5 appears in our catalog under these names: Octachlorocyclopentene, 95%, Octachlorocyclopentene, Octachlorocyclopentene(>90%), Octachlorocyclopentene, ≥98%, ≥98%, Perchlorocyclopent-1-ene. Offered by: Combi-blocks, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg, 500mg.
1,2,3,3,4,4,5,5-octachlorocyclopentene (CAS 706-78-5) is a chemical compound with the molecular formula C5Cl8 and a molecular weight of 343.7 g/mol. IUPAC name: 1,2,3,3,4,4,5,5-octachlorocyclopentene. InChIKey: DMZRCHJVWAKCAX-UHFFFAOYSA-N.
| Molecular formula | C5Cl8 |
|---|---|
| Molecular weight | 343.7 g/mol |
| IUPAC name | 1,2,3,3,4,4,5,5-octachlorocyclopentene |
| InChIKey | DMZRCHJVWAKCAX-UHFFFAOYSA-N |
| SMILES | C1(=C(C(C(C1(Cl)Cl)(Cl)Cl)(Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)