cas: 336-08-3 — see every product listed under this CAS number, including other names
Octafluoroadipic Acid, >98.0%(GC)(T) (CAS 336-08-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | O0260-5G |
| cas | 336-08-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 408.46 Pln | |
| TCI | 25g | 1293.57 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2,2,3,3,4,4,5,5-octafluorohexanedioic acid (CAS 336-08-3) is a chemical compound with the molecular formula C6H2F8O4 and a molecular weight of 290.06 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octafluorohexanedioic acid. InChIKey: AXRSOGFYDSXLQX-UHFFFAOYSA-N.
| Molecular formula | C6H2F8O4 |
|---|---|
| Molecular weight | 290.06 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octafluorohexanedioic acid |
| InChIKey | AXRSOGFYDSXLQX-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(=O)O)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)