CAS 336-08-3 appears in our catalog under these names: Octafluoroadipic acid, 95%, Octafluoroadipic Acid, Octafluoroadipic acid, Octafluoroadipic Acid, >98.0%(GC)(T), 2,2,3,3,4,4,5,5-Octafluorohexanedioic acid 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 5g, 100g, 25g, 250mg.
2,2,3,3,4,4,5,5-octafluorohexanedioic acid (CAS 336-08-3) is a chemical compound with the molecular formula C6H2F8O4 and a molecular weight of 290.06 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octafluorohexanedioic acid. InChIKey: AXRSOGFYDSXLQX-UHFFFAOYSA-N.
| Molecular formula | C6H2F8O4 |
|---|---|
| Molecular weight | 290.06 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octafluorohexanedioic acid |
| InChIKey | AXRSOGFYDSXLQX-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(=O)O)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)