cas: 623-66-5 — see every product listed under this CAS number, including other names
Octanoic anhydride 95% (CAS 623-66-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A655593-5g |
| cas | 623-66-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 25g | 242.44 Pln | |
| Ambeed | 100g | 637.38 Pln | |
| Ambeed | 500g | 2094.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A655593 |
Octanoyl octanoate (CAS 623-66-5) is a chemical compound with the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. IUPAC name: octanoyl octanoate. InChIKey: RAFYDKXYXRZODZ-UHFFFAOYSA-N.
| Molecular formula | C16H30O3 |
|---|---|
| Molecular weight | 270.41 g/mol |
| IUPAC name | octanoyl octanoate |
| InChIKey | RAFYDKXYXRZODZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OC(=O)CCCCCCC |
Computed by PubChem (NCBI)