cas: 623-66-5 — see every product listed under this CAS number, including other names
n-Octanoic Anhydride, >95.0%(GC)(T) (CAS 623-66-5) is a chemical reagent available from Chemat. Available pack sizes: 25ml, 500ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | O0035-25ML |
| cas | 623-66-5 |
| size | 25ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25ml | 321.44 Pln | |
| TCI | 500ml | 2012.98 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC)(T) |
Octanoyl octanoate (CAS 623-66-5) is a chemical compound with the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. IUPAC name: octanoyl octanoate. InChIKey: RAFYDKXYXRZODZ-UHFFFAOYSA-N.
| Molecular formula | C16H30O3 |
|---|---|
| Molecular weight | 270.41 g/mol |
| IUPAC name | octanoyl octanoate |
| InChIKey | RAFYDKXYXRZODZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OC(=O)CCCCCCC |
Computed by PubChem (NCBI)