CAS 2231294-96-3 appears in our catalog under these names: Opevesostat/ 99.25% (existing batch purity), Opevesostat, Opevesostat, 99.79%, 2-(Isoindolin-2-ylmethyl)-5-((1-(methylsulfonyl)piperidin-4-yl)methoxy)-4H-pyran-4-one, 98%, 98%, Opevesostat, 99%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 5 mg.
2-(1,3-dihydroisoindol-2-ylmethyl)-5-[(1-methylsulfonylpiperidin-4-yl)methoxy]pyran-4-one (CAS 2231294-96-3) is a chemical compound with the molecular formula C21H26N2O5S and a molecular weight of 418.5 g/mol. IUPAC name: 2-(1,3-dihydroisoindol-2-ylmethyl)-5-[(1-methylsulfonylpiperidin-4-yl)methoxy]pyran-4-one. InChIKey: LHVKCOBGLZGRQZ-UHFFFAOYSA-N.
| Molecular formula | C21H26N2O5S |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | 2-(1,3-dihydroisoindol-2-ylmethyl)-5-[(1-methylsulfonylpiperidin-4-yl)methoxy]pyran-4-one |
| InChIKey | LHVKCOBGLZGRQZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC(CC1)COC2=COC(=CC2=O)CN3CC4=CC=CC=C4C3 |
Computed by PubChem (NCBI)