CAS 142494-13-1 appears in our catalog under these names: Org-13011 fumarate/ 98.61% (existing batch purity), Org-13011 fumarate, Org-13011 (fumarate). Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, Get quote.
(E)-but-2-enedioic acid;1-[4-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butyl]pyrrolidin-2-one (CAS 142494-13-1) is a chemical compound with the molecular formula C22H29F3N4O5 and a molecular weight of 486.5 g/mol. IUPAC name: (E)-but-2-enedioic acid;1-[4-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butyl]pyrrolidin-2-one. InChIKey: KILJTUTVUORPFQ-WLHGVMLRSA-N.
| Molecular formula | C22H29F3N4O5 |
|---|---|
| Molecular weight | 486.5 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;1-[4-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butyl]pyrrolidin-2-one |
| InChIKey | KILJTUTVUORPFQ-WLHGVMLRSA-N |
| SMILES | C1CC(=O)N(C1)CCCCN2CCN(CC2)C3=NC=CC(=C3)C(F)(F)F.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)