CAS 960155-19-5 appears in our catalog under these names: Orilotimod potassium/ 98.33% (existing batch purity), Orilotimod potassium. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
CAS 960155-19-5 identifies a chemical compound with the molecular formula C16H19KN3O5 and a molecular weight of 372.44 g/mol. InChIKey: MLVYMXUKAGCKFZ-LOCPCMAASA-N.
| Molecular formula | C16H19KN3O5 |
|---|---|
| Molecular weight | 372.44 g/mol |
| InChIKey | MLVYMXUKAGCKFZ-LOCPCMAASA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@H](C(=O)O)NC(=O)CC[C@H](C(=O)O)N.[K] |
Computed by PubChem (NCBI)