cas: 68399-76-8 — see every product listed under this CAS number, including other names
Orotic acid zinc 98% (CAS 68399-76-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A178084-100mg |
| cas | 68399-76-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 565.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A178084 |
Zinc bis(2,4-dioxo-1H-pyrimidine-6-carboxylate) (CAS 68399-76-8) is a chemical compound with the molecular formula C10H6N4O8Zn and a molecular weight of 375.6 g/mol. IUPAC name: zinc bis(2,4-dioxo-1H-pyrimidine-6-carboxylate). InChIKey: YNMDOZLVAPMCBD-UHFFFAOYSA-L.
| Molecular formula | C10H6N4O8Zn |
|---|---|
| Molecular weight | 375.6 g/mol |
| IUPAC name | zinc bis(2,4-dioxo-1H-pyrimidine-6-carboxylate) |
| InChIKey | YNMDOZLVAPMCBD-UHFFFAOYSA-L |
| SMILES | C1=C(NC(=O)NC1=O)C(=O)[O-].C1=C(NC(=O)NC1=O)C(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)