CAS 68399-76-8 appears in our catalog under these names: Zinc orotate, 98%, Orotic acid zinc, 97%, Orotic acid zinc salt dihydrate, Orotic acid zinc/ 100%, Zinc orotate. Offered by: Combi-blocks, AmBeed, GLPBio, TargetMol, Biosynth. Available pack sizes: 25g, 5g, 1g, 10g, 50g, 50mg, 100mg, 200mg.
Zinc bis(2,4-dioxo-1H-pyrimidine-6-carboxylate) (CAS 68399-76-8) is a chemical compound with the molecular formula C10H6N4O8Zn and a molecular weight of 375.6 g/mol. IUPAC name: zinc bis(2,4-dioxo-1H-pyrimidine-6-carboxylate). InChIKey: YNMDOZLVAPMCBD-UHFFFAOYSA-L.
| Molecular formula | C10H6N4O8Zn |
|---|---|
| Molecular weight | 375.6 g/mol |
| IUPAC name | zinc bis(2,4-dioxo-1H-pyrimidine-6-carboxylate) |
| InChIKey | YNMDOZLVAPMCBD-UHFFFAOYSA-L |
| SMILES | C1=C(NC(=O)NC1=O)C(=O)[O-].C1=C(NC(=O)NC1=O)C(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)