cas: 152333-94-3 — see every product listed under this CAS number, including other names
Oxiran-2-ylmethyl 3-nitrobenzenesulfonate 95% (CAS 152333-94-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1360921-100mg |
| cas | 152333-94-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 1060.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1360921 |
Oxiran-2-ylmethyl 3-nitrobenzenesulfonate (CAS 152333-94-3) is a chemical compound with the molecular formula C9H9NO6S and a molecular weight of 259.24 g/mol. IUPAC name: oxiran-2-ylmethyl 3-nitrobenzenesulfonate. InChIKey: AIHIHVZYAAMDPM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO6S |
|---|---|
| Molecular weight | 259.24 g/mol |
| IUPAC name | oxiran-2-ylmethyl 3-nitrobenzenesulfonate |
| InChIKey | AIHIHVZYAAMDPM-UHFFFAOYSA-N |
| SMILES | C1C(O1)COS(=O)(=O)C2=CC=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)