Products 929000-10-2

CAS 929000-10-2 is the registry number for 2-(4-(Methylsulfonyl)-2-nitrophenyl)acetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-methylsulfonyl-2-nitrophenyl)acetic acid (CAS 929000-10-2) is a chemical compound with the molecular formula C9H9NO6S and a molecular weight of 259.24 g/mol. IUPAC name: 2-(4-methylsulfonyl-2-nitrophenyl)acetic acid. InChIKey: XTYIZYUGJXPLRU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO6S
Molecular weight259.24 g/mol
IUPAC name2-(4-methylsulfonyl-2-nitrophenyl)acetic acid
InChIKeyXTYIZYUGJXPLRU-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC(=C(C=C1)CC(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)