CAS 1247819-59-5 appears in our catalog under these names: P22077, P 22077/ 98.42% (existing batch purity), P 22077, 1-(5-((2,4-Difluorophenyl)thio)-4-nitrothiophen-2-yl)ethanone, 99%, 99%, P 22077, 98.42%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 50mg, 2mg, 5mg, 25mg, 100mg, 1g, 10mM (in 1ml dmso).
1-[5-(2,4-difluorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone (CAS 1247819-59-5) is a chemical compound with the molecular formula C12H7F2NO3S2 and a molecular weight of 315.3 g/mol. IUPAC name: 1-[5-(2,4-difluorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone. InChIKey: RMAMGGNACJHXHO-UHFFFAOYSA-N.
| Molecular formula | C12H7F2NO3S2 |
|---|---|
| Molecular weight | 315.3 g/mol |
| IUPAC name | 1-[5-(2,4-difluorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone |
| InChIKey | RMAMGGNACJHXHO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(S1)SC2=C(C=C(C=C2)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)