CAS 882257-11-6 appears in our catalog under these names: P005091, P005091/ 99.87% (existing batch purity), P005091 99+%, P005091, 99.92%, 1-[5-(2,3-Dichloro-phenylsulfanyl)-4-nitro-thiophen-2-yl]-ethanone, 99+%. Offered by: GLPBio, TargetMol, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 10mg, 10mM (in 1ml dmso), 50mg, 2mg, 5mg, 25mg, 100mg, 1mg.
1-[5-(2,3-dichlorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone (CAS 882257-11-6) is a chemical compound with the molecular formula C12H7Cl2NO3S2 and a molecular weight of 348.2 g/mol. IUPAC name: 1-[5-(2,3-dichlorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone. InChIKey: LKZLGMAAKNEGCH-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2NO3S2 |
|---|---|
| Molecular weight | 348.2 g/mol |
| IUPAC name | 1-[5-(2,3-dichlorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone |
| InChIKey | LKZLGMAAKNEGCH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(S1)SC2=C(C(=CC=C2)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)