CAS 1809031-84-2 appears in our catalog under these names: P62-mediated mitophagy inducer/ 99.35% (existing batch purity), P62–mediated mitophagy inducer, 1-(3-Iodophenyl)-4-(3-nitrophenyl)-1H-1,2,3-triazole, P62-mediated mitophagy inducer, 99.54%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
1-(3-iodophenyl)-4-(3-nitrophenyl)triazole (CAS 1809031-84-2) is a chemical compound with the molecular formula C14H9IN4O2 and a molecular weight of 392.15 g/mol. IUPAC name: 1-(3-iodophenyl)-4-(3-nitrophenyl)triazole. InChIKey: LSVWEYNSNZJEGB-UHFFFAOYSA-N.
| Molecular formula | C14H9IN4O2 |
|---|---|
| Molecular weight | 392.15 g/mol |
| IUPAC name | 1-(3-iodophenyl)-4-(3-nitrophenyl)triazole |
| InChIKey | LSVWEYNSNZJEGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CN(N=N2)C3=CC(=CC=C3)I |
Computed by PubChem (NCBI)