CAS 52540-99-5 is the registry number for 3-(isonicotinylhydrazidyl)-5-iodo-2-oxoindoline. Offered by: Biosynth. Available pack sizes: 250mg.
N-[(2-hydroxy-5-iodo-1H-indol-3-yl)imino]pyridine-4-carboxamide (CAS 52540-99-5) is a chemical compound with the molecular formula C14H9IN4O2 and a molecular weight of 392.15 g/mol. IUPAC name: N-[(2-hydroxy-5-iodo-1H-indol-3-yl)imino]pyridine-4-carboxamide. InChIKey: MBCWFZIYMSFARC-UHFFFAOYSA-N.
| Molecular formula | C14H9IN4O2 |
|---|---|
| Molecular weight | 392.15 g/mol |
| IUPAC name | N-[(2-hydroxy-5-iodo-1H-indol-3-yl)imino]pyridine-4-carboxamide |
| InChIKey | MBCWFZIYMSFARC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C(=C(N2)O)N=NC(=O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)