CAS 1235481-90-9 appears in our catalog under these names: P7C3-A20/ 96.83% (existing batch purity), P7C3–A20, P7C3-A20, P7C3-A20, 95%, 95%, P7C3-A20, 98.79%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 500mg, 10mM/1mL.
N-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]-3-methoxyaniline (CAS 1235481-90-9) is a chemical compound with the molecular formula C22H19Br2FN2O and a molecular weight of 506.2 g/mol. IUPAC name: N-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]-3-methoxyaniline. InChIKey: XNLTWMQBJFWQOU-UHFFFAOYSA-N.
| Molecular formula | C22H19Br2FN2O |
|---|---|
| Molecular weight | 506.2 g/mol |
| IUPAC name | N-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]-3-methoxyaniline |
| InChIKey | XNLTWMQBJFWQOU-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)NCC(CN2C3=C(C=C(C=C3)Br)C4=C2C=CC(=C4)Br)F |
Computed by PubChem (NCBI)