Products 1401089-31-3
CAS 1401089-31-3 appears in our catalog under these names: PACMA 31, PACMA 31 99%, PACMA 31, 99.32%, PACMA 31 (Standard), PACMA 31, 99%, 99%. Offered by: GLPBio, Ambeed, MedChemExpress, Chemat, TargetMol. Available pack sizes: 1mg, 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 250mg.
Ethyl 2-[[2-(2,4-dimethoxy-N-prop-2-ynoylanilino)-2-thiophen-2-ylacetyl]amino]acetate (CAS 1401089-31-3) is a chemical compound with the molecular formula C21H22N2O6S and a molecular weight of 430.5 g/mol. IUPAC name: ethyl 2-[[2-(2,4-dimethoxy-N-prop-2-ynoylanilino)-2-thiophen-2-ylacetyl]amino]acetate. InChIKey: AHOOZADJPNUFOQ-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O6S |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | ethyl 2-[[2-(2,4-dimethoxy-N-prop-2-ynoylanilino)-2-thiophen-2-ylacetyl]amino]acetate |
| InChIKey | AHOOZADJPNUFOQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC(=O)C(C1=CC=CS1)N(C2=C(C=C(C=C2)OC)OC)C(=O)C#C |
Computed by PubChem (NCBI)