Products 3032621-10-3
CAS 3032621-10-3 appears in our catalog under these names: PARP-1/HDAC-IN-1/ 95.94% (existing batch purity), PARP-1/HDAC-IN-1. Offered by: TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
2-[4-[[4-(hydroxycarbamoyl)phenyl]methoxy]phenyl]indazole-7-carboxamide (CAS 3032621-10-3) is a chemical compound with the molecular formula C22H18N4O4 and a molecular weight of 402.4 g/mol. IUPAC name: 2-[4-[[4-(hydroxycarbamoyl)phenyl]methoxy]phenyl]indazole-7-carboxamide. InChIKey: KASIRBSNIZZVJQ-UHFFFAOYSA-N.
| Molecular formula | C22H18N4O4 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 2-[4-[[4-(hydroxycarbamoyl)phenyl]methoxy]phenyl]indazole-7-carboxamide |
| InChIKey | KASIRBSNIZZVJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN(N=C2C(=C1)C(=O)N)C3=CC=C(C=C3)OCC4=CC=C(C=C4)C(=O)NO |
Computed by PubChem (NCBI)