CAS 684234-55-7 appears in our catalog under these names: PARP-1-IN-2/ 98.82% (existing batch purity), PARP–1–IN–2, N-(3-Chlorophenyl)-2-(4-(4-chlorophenyl)-1-oxophthalazin-2(1H)-yl)acetamide, 98%, 98%, PARP-1-IN-2, 99.48%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
N-(3-chlorophenyl)-2-[4-(4-chlorophenyl)-1-oxophthalazin-2-yl]acetamide (CAS 684234-55-7) is a chemical compound with the molecular formula C22H15Cl2N3O2 and a molecular weight of 424.3 g/mol. IUPAC name: N-(3-chlorophenyl)-2-[4-(4-chlorophenyl)-1-oxophthalazin-2-yl]acetamide. InChIKey: ASIIOGZHCMSESG-UHFFFAOYSA-N.
| Molecular formula | C22H15Cl2N3O2 |
|---|---|
| Molecular weight | 424.3 g/mol |
| IUPAC name | N-(3-chlorophenyl)-2-[4-(4-chlorophenyl)-1-oxophthalazin-2-yl]acetamide |
| InChIKey | ASIIOGZHCMSESG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN(C2=O)CC(=O)NC3=CC(=CC=C3)Cl)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)