CAS 74472-40-5 is the registry number for PCB No. 145 10 µg/mL in Isooctane. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10ml.
1,2,3,5-tetrachloro-4-(2,6-dichlorophenyl)benzene (CAS 74472-40-5) is a chemical compound with the molecular formula C12H4Cl6 and a molecular weight of 360.9 g/mol. IUPAC name: 1,2,3,5-tetrachloro-4-(2,6-dichlorophenyl)benzene. InChIKey: JZFZCLFEPXCRCA-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl6 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 1,2,3,5-tetrachloro-4-(2,6-dichlorophenyl)benzene |
| InChIKey | JZFZCLFEPXCRCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=C(C(=C(C=C2Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)