Products 74472-40-5

CAS 74472-40-5 is the registry number for PCB No. 145 10 µg/mL in Isooctane. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10ml.

Structural formula: {0} (CAS {1})

1,2,3,5-tetrachloro-4-(2,6-dichlorophenyl)benzene (CAS 74472-40-5) is a chemical compound with the molecular formula C12H4Cl6 and a molecular weight of 360.9 g/mol. IUPAC name: 1,2,3,5-tetrachloro-4-(2,6-dichlorophenyl)benzene. InChIKey: JZFZCLFEPXCRCA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H4Cl6
Molecular weight360.9 g/mol
IUPAC name1,2,3,5-tetrachloro-4-(2,6-dichlorophenyl)benzene
InChIKeyJZFZCLFEPXCRCA-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)C2=C(C(=C(C=C2Cl)Cl)Cl)Cl)Cl

Computed by PubChem (NCBI)