CAS 41411-62-5 appears in our catalog under these names: PCB No. 160, PCB No. 160 10 µg/mL in Isooctane, 2,3,3',4,5,6–Hexachlorobiphenyl, 2,3,3',4,5,6-Hexachlorobiphenyl, PCB 160, ROTI®Star, 10 mg, glass. Offered by: Dr. Ehrenstorfer, GLPBio, Biosynth, Roth, HPC Standards. Available pack sizes: 10mg, 10ml, 1ml, 5mg, 25mg, 50mg, 1x5ml.
1,2,3,4,5-pentachloro-6-(3-chlorophenyl)benzene (CAS 41411-62-5) is a chemical compound with the molecular formula C12H4Cl6 and a molecular weight of 360.9 g/mol. IUPAC name: 1,2,3,4,5-pentachloro-6-(3-chlorophenyl)benzene. InChIKey: JHJMZCXLJXRCHK-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl6 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 1,2,3,4,5-pentachloro-6-(3-chlorophenyl)benzene |
| InChIKey | JHJMZCXLJXRCHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=C(C(=C(C(=C2Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)