CAS 74472-45-0 appears in our catalog under these names: PCB No. 164, PCB No. 164 10 µg/mL in Isooctane, 2,3,3',4',5',6-Hexachlorobiphenyl, PCB 164, ROTI®Star, 5 mg, glass, PCB 164, Concentration: 10.0 µg/ml Solvent: Isooctane. Offered by: Dr. Ehrenstorfer, Biosynth, Roth, HPC Standards. Available pack sizes: 5mg, 10ml, 10mg, 25mg, 50mg, 1x10ml, 1x1ml.
1,2,3-trichloro-5-(2,3,6-trichlorophenyl)benzene (CAS 74472-45-0) is a chemical compound with the molecular formula C12H4Cl6 and a molecular weight of 360.9 g/mol. IUPAC name: 1,2,3-trichloro-5-(2,3,6-trichlorophenyl)benzene. InChIKey: HAZQOLYHFUUJJN-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl6 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 1,2,3-trichloro-5-(2,3,6-trichlorophenyl)benzene |
| InChIKey | HAZQOLYHFUUJJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)C2=CC(=C(C(=C2)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)