CAS 1668565-74-9 appears in our catalog under these names: PCC0208009/ 99.89% (existing batch purity), IDO–IN–2, IDO-IN-2, PCC0208009, 99%, 99%, PCC0208009, 98.06%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
1-[2-[bis(2-methylpropyl)amino]-5-[2-(2H-tetrazol-5-yl)phenyl]phenyl]-3-(4-methylphenyl)urea (CAS 1668565-74-9) is a chemical compound with the molecular formula C29H35N7O and a molecular weight of 497.6 g/mol. IUPAC name: 1-[2-[bis(2-methylpropyl)amino]-5-[2-(2H-tetrazol-5-yl)phenyl]phenyl]-3-(4-methylphenyl)urea. InChIKey: CJNMMPAEIYFQIJ-UHFFFAOYSA-N.
| Molecular formula | C29H35N7O |
|---|---|
| Molecular weight | 497.6 g/mol |
| IUPAC name | 1-[2-[bis(2-methylpropyl)amino]-5-[2-(2H-tetrazol-5-yl)phenyl]phenyl]-3-(4-methylphenyl)urea |
| InChIKey | CJNMMPAEIYFQIJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)NC2=C(C=CC(=C2)C3=CC=CC=C3C4=NNN=N4)N(CC(C)C)CC(C)C |
Computed by PubChem (NCBI)