CAS 216163-53-0 appears in our catalog under these names: PD 174265/ 98.88% (existing batch purity), PD 174265, PD 174265, 98%, 98%, PD 174265, 98.35%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL, 25 mg.
N-[4-(3-bromoanilino)quinazolin-6-yl]propanamide (CAS 216163-53-0) is a chemical compound with the molecular formula C17H15BrN4O and a molecular weight of 371.2 g/mol. IUPAC name: N-[4-(3-bromoanilino)quinazolin-6-yl]propanamide. InChIKey: WUPUZEMRHDROEO-UHFFFAOYSA-N.
| Molecular formula | C17H15BrN4O |
|---|---|
| Molecular weight | 371.2 g/mol |
| IUPAC name | N-[4-(3-bromoanilino)quinazolin-6-yl]propanamide |
| InChIKey | WUPUZEMRHDROEO-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC1=CC2=C(C=C1)N=CN=C2NC3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)