CAS 2714327-65-6 appears in our catalog under these names: CAY10774, PD-1/PD-L1-IN-36, 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 500μg, 1 mg.
(2S)-1-[[3-bromo-4-[(2-bromo-3-phenylphenyl)methoxy]phenyl]methyl]piperidine-2-carboxylic acid (CAS 2714327-65-6) is a chemical compound with the molecular formula C26H25Br2NO3 and a molecular weight of 559.3 g/mol. IUPAC name: (2S)-1-[[3-bromo-4-[(2-bromo-3-phenylphenyl)methoxy]phenyl]methyl]piperidine-2-carboxylic acid. InChIKey: AHFXYBDSOWECNI-QHCPKHFHSA-N.
| Molecular formula | C26H25Br2NO3 |
|---|---|
| Molecular weight | 559.3 g/mol |
| IUPAC name | (2S)-1-[[3-bromo-4-[(2-bromo-3-phenylphenyl)methoxy]phenyl]methyl]piperidine-2-carboxylic acid |
| InChIKey | AHFXYBDSOWECNI-QHCPKHFHSA-N |
| SMILES | C1CCN([C@@H](C1)C(=O)O)CC2=CC(=C(C=C2)OCC3=C(C(=CC=C3)C4=CC=CC=C4)Br)Br |
Computed by PubChem (NCBI)